|
|
Cat. No.: | BY30021 |
| Product Name: | Canagliflozin intermediate | |
| Synonyms: | 2-(5-bromo-2-methylbenzyl)-5-(4-fluorophenyl)thiophene; 5-bromo-1-[5-(4-fluorophenyl)-2-thienylmethyl]-2-methylbenzene; 2-(5-bromo-2-methyl-benzyl)-5-(4-fluoro-phenyl)-thiophene | |
| IUPAC Name: | 2-[(5-bromo-2-methylphenyl)methyl]-5-(4-fluorophenyl)thiophene | |
| CAS NO.: | 1030825-20-7 | |
| Molecular Formula: | C18H14BrFS | |
| Molecular Weight: | 361.3 | |
| Purity: | 99%+ | |
| Supply Capacity: | mg to kgs |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | VLRIERSBZHUCOW-UHFFFAOYSA-N |
| Reaxys Registry Number: | 18362680 |
| Pub CID: | 46930432 |
| Canonical SMILES: | CC1=C(C=C(C=C1)Br)CC2=CC=C(S2)C3=CC=C(C=C3)F |
| References: |
Patent; TFCHEM; DELIENCOURT-GODEFROY, Geraldine; LOPES, Lenaig; WO2012/160218; A1; (2012); Patent; Mitsubishi Tanabe Pharma Corporation; US2008/146515; A1; (2008); |
|
|
|
|
Note: Products protected by valid patents are not offered for sale in countries where the sale of such products constitutes patent infringement and its liability is at buyer’s risk.
