|
|
Cat. No.: | BY30003 |
| Product Name: | Dapagliflozin intermediate | |
| Synonyms: | 1-chloro-2-(4-ethoxybenzyl)-4-iodobenzene; 1 -chloro-2-(4-ethoxybenzyl)-4-iodobenzene | |
| IUPAC Name: | 1-chloro-2-[(4-ethoxyphenyl)methyl]-4-iodobenzene | |
| CAS NO.: | 1103738-29-9 | |
| Molecular Formula: | C15H14ClIO | |
| Molecular Weight: | 372.633 | |
| Purity: | 99%+ | |
| Supply Capacity: | mg to kgs |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | CZFRIPGHKLGMEU-UHFFFAOYSA-N |
| Reaxys Registry Number: | 18768594 |
| Pub CID: | 25207582 |
| Canonical SMILES: | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)I)Cl |
| References: | Patent; Theracos, Inc.; Xu, Baihua; Lv, Binhua; Xu, Ge; Seed, Brian; Roberge, Jacques Y.; US2013/267694; A1; (2013); |
|
|
|
|
Note: Products protected by valid patents are not offered for sale in countries where the sale of such products constitutes patent infringement and its liability is at buyer’s risk.
