|
|
Cat. No.: | BY60031 |
| Product Name: | Isobergaptol | |
| Synonyms: | 5-hydroxy-furo[2,3-h]chromen-2-one; Isobergaptol | |
| IUPAC Name: | 5-hydroxyfuro[2,3-h]chromen-2-one | |
| CAS NO.: | 21339-45-7 | |
| Molecular Formula: | C11H6O4 | |
| Molecular Weight: | 202.17 | |
| Purity: | 98%+ | |
| Supply Capacity: | mg to grams |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | OOWBIFOFDYBTAE-UHFFFAOYSA-N |
| Reaxys Registry Number: | 1376993 |
| Pub CID: | 10198122 |
| Canonical SMILES: | C1=CC(=O)OC2=C3C=COC3=CC(=C21)O |
| References: |
Article; Gupta et al.; Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry; vol. 16; (1978); p. 38; Article; Chatterjee et al.; Indian Journal of Chemistry; vol. 6; (1968); p. 415,419; |
|
|
|
|
For research use only. Not as drugs for human and animals.