|
|
Cat. No.: | BY60034 |
| Product Name: | 6-Isopentenyloxyisobergapten | |
| Synonyms: | 6-isopentenyloxy isobergapten; isophellopterin; 5-methoxy-6-(3-methyl-but-2-enyloxy)-furo[2,3-h]chromen-2-one | |
| IUPAC Name: | 5-methoxy-6-(3-methylbut-2-enoxy)furo[2,3-h]chromen-2-one | |
| CAS NO.: | 24099-29-4 | |
| Molecular Formula: | C17H16O5 | |
| Molecular Weight: | 300.31 | |
| Purity: | 98%+ | |
| Supply Capacity: | mg to grams |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | QYROBYWPUVLPTM-UHFFFAOYSA-N |
| Reaxys Registry Number: | 1260955 |
| Pub CID: | 3084412 |
| Canonical SMILES: | CC(=CCOC1=C(C2=C(C3=C1OC=C3)OC(=O)C=C2)OC)C |
| References: |
Article; Reed, Michael W.; Moore, Harold W.; Journal of Organic Chemistry; vol. 53; 8; (1988); p. 4166 - 4171; Article; Dreyer; Journal of Organic Chemistry; vol. 35; (1970); p. 2294; |
|
|
|
|
For research use only. Not as drugs for human and animals.