|
|
Cat. No.: | BY60020 |
| Product Name: | Gosferol | |
| Synonyms: | Pabulenol; pabulenol; pangelin; 4-(2-hydroxy-3-methyl-but-3-enyloxy)-furo[3,2-g]chromen-7-one; Pabutenol; Gosferol | |
| IUPAC Name: | 4-(2-hydroxy-3-methylbut-3-enoxy)furo[3,2-g]chromen-7-one | |
| CAS NO.: | 37551-62-5 | |
| Molecular Formula: | C16H14O5 | |
| Molecular Weight: | 286.28 | |
| Purity: | 98%+ | |
| Supply Capacity: | mg to grams |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | BVMOMQJYQYBMKL-UHFFFAOYSA-N |
| Reaxys Registry Number: | 1627735 |
| Pub CID: | 511358 |
| Canonical SMILES: | CC(=C)C(COC1=C2C=CC(=O)OC2=CC3=C1C=CO3)O |
| References: |
Article; Li, Bin; Zhang, Xu; Wang, Juan; Zhang, Le; Gao, Bowen; Shi, Shepo; Wang, Xiaohui; Li, Jun; Tu, Pengfei; Phytochemical Analysis; vol. 25; 3; (2014); p. 229 - 240; Article; Joshi, Prashant; Singh, Samsher; Wani, Abubakar; Sharma, Sadhana; Jain, Shreyans K.; Singh, Baljinder; Gupta, Bishan D.; Satti, Naresh K.; Koul, Surrinder; Khan, Inshad A.; Kumar, Ajay; Bharate, Sandip B.; Vishwakarma, Ram A.; MedChemComm; vol. 5; 10; (2014); p. 1540 - 1547; Article; Shi, Xiaowei; Liu, Man; Zhang, Min; Zhang, Kerong; Liu, Songchen; Qiao, Shi; Shi, Rui; Jiang, Xijuan; Wang, Qiao; Food Chemistry; vol. 141; 1; (2013); p. 357 - 365; |
|
|
|
|
For research use only. Not as drugs for human and animals.