|
|
Cat. No.: | BY30038 |
| Product Name: | 2-(4-FLUOROPHENYL)THIOPHENE | |
| Synonyms: |
Canagliflozin Intermediate;IFLAB-BB F2108-0130; 2-(4- FLUOROPHENYL)THIOPHENE;AKOS BAR-1344;Thiophene, 2-(4-fluorophenyl)-;Canagliflozin Intermediate I |
|
| IUPAC Name: | 2-(4-fluorophenyl)thiophene | |
| CAS No.: | 58861-48-6 | |
| Molecular Formula: | C10H7FS | |
| Molecular Weight: | 178.23 | |
| Purity: | 99%+ | |
| Supply Capacity: | mg to kgs |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | PURJRGMZIKXDMW-UHFFFAOYSA-N |
| Reaxys Registry Number: | 1563859 |
| Pub CID: | 21894783 |
| Canonical SMILES: | C1=CSC(=C1)C2=CC=C(C=C2)F |
| References: |
Article; Shen, Hongyun; Shen, Chao; Chen, Chao; Wang, Anming; Zhang, Pengfei; Catalysis Science and Technology; vol. 5; 4; (2015); p. 2065 - 2071; Patent; BIOMARIN PHARMACEUTICAL INC.; WANG, Bing; CHU, Daniel; BRIDGES, Alexander, James; WO2015/42397; A1; (2015); Article; Tang, Dan-Tam D.; Collins, Karl D.; Ernst, Johannes B.; Glorius, Frank; Angewandte Chemie - International Edition; vol. 53; 7; (2014); p. 1809 - 1813; Angew. Chem.; vol. 126; 07; (2014); p. 1840 - 1844,5; |
|
|
|
|
