|
|
Cat. No.: | BY60047 |
| Product Name: | Sphondinol | |
| Synonyms: | heratomol; 6-hydroxy-furo[2,3-h]chromen-2-one; 6-Hydroxy-furano-<2',3'-7,8>cumarin; Heratomol (6-Hydroxyangelicin); Heratomol | |
| IUPAC Name: | 6-hydroxyfuro[2,3-h]chromen-2-one | |
| CAS NO.: | 61265-07-4 | |
| Molecular Formula: | C11H6O4 | |
| Molecular Weight: | 202.16 | |
| Purity: | 98%+ | |
| Supply Capacity: | mg to grams |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | ZKCVFMVZXPEHMD-UHFFFAOYSA-N |
| Reaxys Registry Number: | 1346645 |
| Pub CID: | 10465441 |
| Canonical SMILES: | C1=CC(=O)OC2=C3C=COC3=C(C=C21)O |
| References: |
Article; Joshi, Prashant; Singh, Samsher; Wani, Abubakar; Sharma, Sadhana; Jain, Shreyans K.; Singh, Baljinder; Gupta, Bishan D.; Satti, Naresh K.; Koul, Surrinder; Khan, Inshad A.; Kumar, Ajay; Bharate, Sandip B.; Vishwakarma, Ram A.; MedChemComm; vol. 5; 10; (2014); p. 1540 - 1547; Article; Sardari, Soroush; Nishibe; Horita; Nikaido; Daneshtalab; Pharmazie; vol. 54; 7; (1999); p. 554 - 556; |
|
|
|
|
For research use only. Not as drugs for human and animals.