|
|
Cat. No.: | BY60041 |
| Product Name: | Oxypeucedanin | |
| Synonyms: | Oxypeucadanin; (+/-)-oxypeucedanin; oxypeucedanin; 4-(3,3-dimethyl-oxiranylmethoxy)-furo[3,2-g]chromen-7-one; 4-(2,3-epoxy-3-methyl-butoxy)-furo[3,2-g]chromen-7-one; 4-(2,3-Epoxy-3-methyl-butoxy)-furo[3,2-g]chromen-7-on | |
| IUPAC Name: | 4-[(3,3-dimethyloxiran-2-yl)methoxy]furo[3,2-g]chromen-7-one | |
| CAS NO.: | 737-52-0 | |
| Molecular Formula: | C16H14O5 | |
| Molecular Weight: | 286.28 | |
| Purity: | 98%+ | |
| Supply Capacity: | mg to grams |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | QTAGQHZOLRFCBU-UHFFFAOYSA-N |
| Reaxys Registry Number: | 275086 |
| Pub CID: | 160544 |
| Canonical SMILES: | CC1(C(O1)COC2=C3C=CC(=O)OC3=CC4=C2C=CO4)C |
| References: |
Article; Ghosal et al.; Chemistry and Industry (London, United Kingdom); (1963); p. 1430; Article; Spaeth; Klager; Chemische Berichte; vol. 66; (1933); p. 914,920; Article; Butenandt; Marten; Justus Liebigs Annalen der Chemie; vol. 495; (1932); p. 187,202; |
|
|
|
|
For research use only. Not as drugs for human and animals.