|
|
Cat. No.: | BY60045 |
| Product Name: | Sen-Byakangelicol | |
| Synonyms: | 7H-Furo[3,2-g][1]benzopyran-7-one, 4,9-bis[(3,3-dimethyloxiranyl)methoxy]- (9CI) | |
| IUPAC Name: | 4,9-bis[(3,3-dimethyloxiran-2-yl)methoxy]furo[3,2-g]chromen-7-one | |
| CAS NO.: | 77063-74-2 | |
| Molecular Formula: | C21H22O7 | |
| Molecular Weight: | 386.40 | |
| Purity: | 98%+ | |
| Supply Capacity: | mg to grams |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | ZQVSNPBYAYVIGW-UHFFFAOYSA-N |
| Reaxys Registry Number: | N/A |
| Pub CID: | 156995 |
| Canonical SMILES: | CC1(C(O1)COC2=C3C=COC3=C(C4=C2C=CC(=O)O4)OCC5C(O5)(C)C)C |
| References: | N/A |
|
|
|
|
For research use only. Not as drugs for human and animals.