|
|
Cat. No.: | BY10002 |
| Product Name: | Canagliflozin | |
| Synonyms: | N/A | |
| IUPAC Name: | (2S,3R,4R,5S,6R)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol | |
| CAS NO.: | 842133-18-0 | |
| Molecular Formula: | C24H25FO5S | |
| Molecular Weight: | 444.5157032 | |
| Purity: | 99%+ | |
| Supply Capacity: | mg to kgs |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | XTNGUQKDFGDXSJ-ZXGKGEBGSA-N |
| Reaxys Registry Number: | 18362681 |
| Pub CID: | 24812758 |
| Canonical SMILES: | CC1=C(C=C(C=C1)C2C(C(C(C(O2)CO)O)O)O)CC3=CC=C(S3)C4=CC=C(C=C4)F |
| References: |
Patent; JANSSEN PHARMACEUTICA NV; HOUPIS, Ioannis, Nicolaos; LEMAIRE, Sebastien, Francois, Emmanuel; WO2012/140120; A1; (2012); Patent; Theracos, Inc.; US2011/77212; A1; (2011); Patent; JANSSEN PHARMACEUTICA N.V.; MITSUBISHI TANABE PHARMA CORPORATION; WO2009/35969; A1; (2009); |
|
|
|
|
For research use only. Not as drugs for human and animals.
