|
|
Cat. No.: | BY10003 |
| Product Name: | Tedizolid phosphate | |
| Synonyms: | N/A | |
| IUPAC Name: | [(5R)-3-[3-fluoro-4-[6-(2-methyltetrazol-5-yl)pyridin-3-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate | |
| CAS NO.: | 856867-55-5 | |
| Molecular Formula: | C17H16FN6O6P | |
| Molecular Weight: | 450.09 | |
| Purity: | 99%+ | |
| Supply Capacity: | mg to kgs |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | QCGUSIANLFXSGE-GFCCVEGCSA-N |
| Reaxys Registry Number: | N/A |
| Pub CID: | 11476460 |
| Canonical SMILES: | CN1N=C(N=N1)C2=NC=C(C=C2)C3=C(C=C(C=C3)N4CC(OC4=O)COP(=O)(O)O)F |
| References: | N/A |
|
|
|
|
For research use only.Not as drugs for human and animals.