|
|
Cat. No.: | BY10004 |
| Product Name: | Vortioxetine hydrobromide | |
| Synonyms: | Brintellix | |
| IUPAC Name: |
1-[2-(2,4-dimethylphenyl)sulfanylphen yl]piperazine; hydrobromide |
|
| CAS NO.: | 960203-27-4 | |
| Molecular Formula: | BrH*C18H22N2S | |
| Molecular Weight: | 379.364 | |
| Purity: | 99%+ | |
| Supply Capacity: | mg to kgs |
|
Download |
|
| COA | MSDS |
|
Delivery Time(in stock products) |
|
| Within three or four working days. |
|
Reference information
|
|
| InChI Key: | VNGRUFUIHGGOOM-UHFFFAOYSA-N |
| Reaxys Registry Number: | 15607074 |
| Pub CID: | 56843850 |
| Canonical SMILES: | CC1=CC(=C(C=C1)SC2=CC=CC=C2N3CCNCC3)C.Br |
| References: |
Patent; LEK PHARMACEUTICALS D.D.; ZUPANCIC, Borut; WO2014/161976; A1; (2014); Patent; LEK PHARMACEUTICALS D.D.; ZUPANCIC, Borut; WO2014/191548; A1; (2014); |
|
|
|
|
For research use only. Not as drugs for human and animals.